C17H21F2NO3 — CID 53491406
methyl (2S,3aR,6R,7aR)-1-[(2,5-difluorophenyl)methyl]-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 53491406) has the molecular formula C17H21F2NO3 and a molecular weight of 325.36 g/mol. Its IUPAC name is methyl (2S,3aR,6R,7aR)-1-[(2,5-difluorophenyl)methyl]-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aR,6R,7aR)-1-[(2,5-difluorophenyl)methyl]-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 53491406 |
| Molecular Formula | C17H21F2NO3 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | methyl (2S,3aR,6R,7aR)-1-[(2,5-difluorophenyl)methyl]-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2CC[C@@H](O)C[C@H]2N1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C17H21F2NO3/c1-23-17(22)16-7-10-2-4-13(21)8-15(10)20(16)9-11-6-12(18)3-5-14(11)19/h3,5-6,10,13,15-16,21H,2,4,7-9H2,1H3/t10-,13-,15-,16+/m1/s1 |
| InChIKey | NRZRNVQRTSEWHD-NMFKLSHFSA-N |
| XLogP | 2.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |