About pentan-2-yl 2-methylprop-2-enoate
pentan-2-yl 2-methylprop-2-enoate (PubChem CID 534915) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is pentan-2-yl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | pentan-2-yl 2-methylprop-2-enoate |
| PubChem CID | 534915 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | pentan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)CCC |
| InChI | InChI=1S/C9H16O2/c1-5-6-8(4)11-9(10)7(2)3/h8H,2,5-6H2,1,3-4H3 |
| InChIKey | QSYOAKOOQMVVTO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-yl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl 2-methylprop-2-enoate?
The IUPAC name of pentan-2-yl 2-methylprop-2-enoate (CID 534915) is pentan-2-yl 2-methylprop-2-enoate.
What is the SMILES notation for pentan-2-yl 2-methylprop-2-enoate?
The canonical SMILES for pentan-2-yl 2-methylprop-2-enoate is C=C(C)C(=O)OC(C)CCC.
What is the InChIKey of pentan-2-yl 2-methylprop-2-enoate?
The InChIKey is QSYOAKOOQMVVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-5-6-8(4)11-9(10)7(2)3/h8H,2,5-6H2,1,3-4H3.
What are the key properties of pentan-2-yl 2-methylprop-2-enoate?
pentan-2-yl 2-methylprop-2-enoate has a molecular weight of 156.22 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl 2-methylprop-2-enoate is sourced from PubChem (CID 534915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).