C19H18ClN3 — CID 53491545
3-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)propanenitrile (PubChem CID 53491545) has the molecular formula C19H18ClN3 and a molecular weight of 323.83 g/mol. Its IUPAC name is 3-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)propanenitrile.
| Compound Name | 3-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)propanenitrile |
|---|---|
| PubChem CID | 53491545 |
| Molecular Formula | C19H18ClN3 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)propanenitrile |
| SMILES | N#CCCC1=CC2Cc3nc4cc(Cl)ccc4c(N)c3C(C1)C2 |
| InChI | InChI=1S/C19H18ClN3/c20-14-3-4-15-16(10-14)23-17-9-12-6-11(2-1-5-21)7-13(8-12)18(17)19(15)22/h3-4,6,10,12-13H,1-2,7-9H2,(H2,22,23) |
| InChIKey | MQQNRQYFOSDSIQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|