C18H19N5 — CID 53491617
15-(2-azidoethyl)-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine (PubChem CID 53491617) has the molecular formula C18H19N5 and a molecular weight of 305.38 g/mol. Its IUPAC name is 15-(2-azidoethyl)-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine.
| Compound Name | 15-(2-azidoethyl)-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine |
|---|---|
| PubChem CID | 53491617 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 15-(2-azidoethyl)-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10,14-hexaen-3-amine |
| SMILES | [N-]=[N+]=NCCC1=CC2Cc3nc4ccccc4c(N)c3C(C1)C2 |
| InChI | InChI=1S/C18H19N5/c19-18-14-3-1-2-4-15(14)22-16-10-12-7-11(5-6-21-23-20)8-13(9-12)17(16)18/h1-4,7,12-13H,5-6,8-10H2,(H2,19,22) |
| InChIKey | RQTGDOKIAWZKNF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|