About (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone
(2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone (PubChem CID 53491729) has the molecular formula C20H17N5O2S
and a molecular weight of 391.46 g/mol. Its IUPAC name is (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone.
Molecular Properties
| Compound Name | (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone |
| PubChem CID | 53491729 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone |
| SMILES | COc1ccccc1C(=O)n1nc(-c2ccccn2)nc1NCc1cccs1 |
| InChI | InChI=1S/C20H17N5O2S/c1-27-17-10-3-2-8-15(17)19(26)25-20(22-13-14-7-6-12-28-14)23-18(24-25)16-9-4-5-11-21-16/h2-12H,13H2,1H3,(H,22,23,24) |
| InChIKey | MSZDFYJGNLJAGU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone?
The IUPAC name of (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone (CID 53491729) is (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone.
What is the SMILES notation for (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone?
The canonical SMILES for (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone is COc1ccccc1C(=O)n1nc(-c2ccccn2)nc1NCc1cccs1.
What is the InChIKey of (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone?
The InChIKey is MSZDFYJGNLJAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N5O2S/c1-27-17-10-3-2-8-15(17)19(26)25-20(22-13-14-7-6-12-28-14)23-18(24-25)16-9-4-5-11-21-16/h2-12H,13H2,1H3,(H,22,23,24).
What are the key properties of (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone?
(2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone has a molecular weight of 391.46 g/mol, XLogP of 3.71, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyphenyl)-[3-pyridin-2-yl-5-(thiophen-2-ylmethylamino)-1,2,4-triazol-1-yl]methanone is sourced from PubChem (CID 53491729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).