C22H22N4O3 — CID 53491754
10-[3-(3-methoxyphenyl)propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 53491754) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 10-[3-(3-methoxyphenyl)propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-[3-(3-methoxyphenyl)propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 53491754 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 10-[3-(3-methoxyphenyl)propyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | COc1cccc(CCCn2c3nc(=O)[nH]c(=O)c-3nc3cc(C)c(C)cc32)c1 |
| InChI | InChI=1S/C22H22N4O3/c1-13-10-17-18(11-14(13)2)26(20-19(23-17)21(27)25-22(28)24-20)9-5-7-15-6-4-8-16(12-15)29-3/h4,6,8,10-12H,5,7,9H2,1-3H3,(H,25,27,28) |
| InChIKey | XRUBOJFVLUOLNG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|