About 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one
2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one (PubChem CID 53492521) has the molecular formula C23H20N4O3
and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one.
Molecular Properties
| Compound Name | 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one |
| PubChem CID | 53492521 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one |
| SMILES | COc1ccc2c(c1C)Oc1ccc(-c3cccnc3)cc1C21N=C(N)N(C)C1=O |
| InChI | InChI=1S/C23H20N4O3/c1-13-18(29-3)9-7-16-20(13)30-19-8-6-14(15-5-4-10-25-12-15)11-17(19)23(16)21(28)27(2)22(24)26-23/h4-12H,1-3H3,(H2,24,26) |
| InChIKey | XLFISQGRMDABIL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one?
The IUPAC name of 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one (CID 53492521) is 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one.
What is the SMILES notation for 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one?
The canonical SMILES for 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one is COc1ccc2c(c1C)Oc1ccc(-c3cccnc3)cc1C21N=C(N)N(C)C1=O.
What is the InChIKey of 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one?
The InChIKey is XLFISQGRMDABIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O3/c1-13-18(29-3)9-7-16-20(13)30-19-8-6-14(15-5-4-10-25-12-15)11-17(19)23(16)21(28)27(2)22(24)26-23/h4-12H,1-3H3,(H2,24,26).
What are the key properties of 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one?
2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one has a molecular weight of 400.44 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6'-methoxy-3,5'-dimethyl-2'-pyridin-3-ylspiro[imidazole-5,9'-xanthene]-4-one is sourced from PubChem (CID 53492521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).