C22H23N3O2S — CID 53492567
2-methyl-4-[(E)-2-(5-thiophen-3-yl-2-pyridinyl)ethenyl]-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizine-1,3-dione (PubChem CID 53492567) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-methyl-4-[(E)-2-(5-thiophen-3-yl-2-pyridinyl)ethenyl]-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizine-1,3-dione.
| Compound Name | 2-methyl-4-[(E)-2-(5-thiophen-3-yl-2-pyridinyl)ethenyl]-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizine-1,3-dione |
|---|---|
| PubChem CID | 53492567 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-methyl-4-[(E)-2-(5-thiophen-3-yl-2-pyridinyl)ethenyl]-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizine-1,3-dione |
| SMILES | CN1C(=O)C2C(C1=O)C1CCCCN1C2/C=C/c1ccc(-c2ccsc2)cn1 |
| InChI | InChI=1S/C22H23N3O2S/c1-24-21(26)19-17-4-2-3-10-25(17)18(20(19)22(24)27)8-7-16-6-5-14(12-23-16)15-9-11-28-13-15/h5-9,11-13,17-20H,2-4,10H2,1H3/b8-7+ |
| InChIKey | VNRBCOQSUOEERT-BQYQJAHWSA-N |
| XLogP | 3.29 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|