C22H22N4O2 — CID 53492640
7,8-dimethyl-10-[3-(4-methylphenyl)propyl]benzo[g]pteridine-2,4-dione (PubChem CID 53492640) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 7,8-dimethyl-10-[3-(4-methylphenyl)propyl]benzo[g]pteridine-2,4-dione.
| Compound Name | 7,8-dimethyl-10-[3-(4-methylphenyl)propyl]benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 53492640 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 7,8-dimethyl-10-[3-(4-methylphenyl)propyl]benzo[g]pteridine-2,4-dione |
| SMILES | Cc1ccc(CCCn2c3nc(=O)[nH]c(=O)c-3nc3cc(C)c(C)cc32)cc1 |
| InChI | InChI=1S/C22H22N4O2/c1-13-6-8-16(9-7-13)5-4-10-26-18-12-15(3)14(2)11-17(18)23-19-20(26)24-22(28)25-21(19)27/h6-9,11-12H,4-5,10H2,1-3H3,(H,25,27,28) |
| InChIKey | XAUJOZYUVORCGO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|