C35H67N2O12+ — CID 53492693
2-[[(Z)-17-[(3R,4S)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyoctadec-9-enoyl]amino]ethyl-trimethylazanium (PubChem CID 53492693) has the molecular formula C35H67N2O12+ and a molecular weight of 707.92 g/mol. Its IUPAC name is 2-[[(Z)-17-[(3R,4S)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyoctadec-9-enoyl]amino]ethyl-trimethylazanium.
| Compound Name | 2-[[(Z)-17-[(3R,4S)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyoctadec-9-enoyl]amino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 53492693 |
| Molecular Formula | C35H67N2O12+ |
| Molecular Weight | 707.92 g/mol |
| Exact Mass | 707.47 |
| IUPAC Name | 2-[[(Z)-17-[(3R,4S)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyoctadec-9-enoyl]amino]ethyl-trimethylazanium |
| SMILES | CC(CCCCCC/C=C\CCCCCCCC(=O)NCC[N+](C)(C)C)OC1OC(CO)C(O)[C@H](O)[C@H]1OC1OC(CO)[C@@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C35H66N2O12/c1-24(18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-27(40)36-20-21-37(2,3)4)46-35-33(31(44)29(42)26(23-39)48-35)49-34-32(45)30(43)28(41)25(22-38)47-34/h5-6,24-26,28-35,38-39,41-45H,7-23H2,1-4H3/p+1/b6-5-/t24?,25?,26?,28-,29?,30+,31+,32?,33-,34?,35?/m1/s1 |
| InChIKey | OXMLWJMVRPZVHE-MAYFXODZSA-O |
| XLogP | 0.47 |
| TPSA | 207.63 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.92 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|