About 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one
4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one (PubChem CID 53492820) has the molecular formula C23H18N4O2
and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one.
Molecular Properties
| Compound Name | 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one |
| PubChem CID | 53492820 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one |
| SMILES | O=C1NCCc2nc(-c3ccccc3)cc(/N=c3\cccc4n(O)cccc3-4)c21 |
| InChI | InChI=1S/C23H18N4O2/c28-23-22-18(11-12-24-23)26-19(15-6-2-1-3-7-15)14-20(22)25-17-9-4-10-21-16(17)8-5-13-27(21)29/h1-10,13-14,29H,11-12H2,(H,24,28)/b25-17+ |
| InChIKey | JXBQLCBKXRARRV-KOEQRZSOSA-N |
| XLogP | 3.41 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one?
The IUPAC name of 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one (CID 53492820) is 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one.
What is the SMILES notation for 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one?
The canonical SMILES for 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one is O=C1NCCc2nc(-c3ccccc3)cc(/N=c3\cccc4n(O)cccc3-4)c21.
What is the InChIKey of 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one?
The InChIKey is JXBQLCBKXRARRV-KOEQRZSOSA-N. The full InChI is InChI=1S/C23H18N4O2/c28-23-22-18(11-12-24-23)26-19(15-6-2-1-3-7-15)14-20(22)25-17-9-4-10-21-16(17)8-5-13-27(21)29/h1-10,13-14,29H,11-12H2,(H,24,28)/b25-17+.
What are the key properties of 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one?
4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one has a molecular weight of 382.42 g/mol, XLogP of 3.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-hydroxyquinolin-5-ylidene)amino]-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one is sourced from PubChem (CID 53492820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).