C21H26N4O2 — CID 53492862
2-N-(3,4-dimethoxyphenyl)-6-N,9-dimethyl-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine (PubChem CID 53492862) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-N-(3,4-dimethoxyphenyl)-6-N,9-dimethyl-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine.
| Compound Name | 2-N-(3,4-dimethoxyphenyl)-6-N,9-dimethyl-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine |
|---|---|
| PubChem CID | 53492862 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-N-(3,4-dimethoxyphenyl)-6-N,9-dimethyl-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine |
| SMILES | CNC1CCc2c(c3ccc(Nc4ccc(OC)c(OC)c4)nc3n2C)C1 |
| InChI | InChI=1S/C21H26N4O2/c1-22-13-5-8-17-16(11-13)15-7-10-20(24-21(15)25(17)2)23-14-6-9-18(26-3)19(12-14)27-4/h6-7,9-10,12-13,22H,5,8,11H2,1-4H3,(H,23,24) |
| InChIKey | OYLJGOSHFXIJAC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |