About 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine
6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 53492917) has the molecular formula C14H15N5S2
and a molecular weight of 317.44 g/mol. Its IUPAC name is 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 53492917 |
| Molecular Formula | C14H15N5S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)c1cc2c(N/N=C/c3nccs3)ncnc2s1 |
| InChI | InChI=1S/C14H15N5S2/c1-14(2,3)10-6-9-12(16-8-17-13(9)21-10)19-18-7-11-15-4-5-20-11/h4-8H,1-3H3,(H,16,17,19)/b18-7+ |
| InChIKey | UQGAUIUITCUNKH-CNHKJKLMSA-N |
| XLogP | 3.89 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine (CID 53492917) is 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine is CC(C)(C)c1cc2c(N/N=C/c3nccs3)ncnc2s1.
What is the InChIKey of 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is UQGAUIUITCUNKH-CNHKJKLMSA-N. The full InChI is InChI=1S/C14H15N5S2/c1-14(2,3)10-6-9-12(16-8-17-13(9)21-10)19-18-7-11-15-4-5-20-11/h4-8H,1-3H3,(H,16,17,19)/b18-7+.
What are the key properties of 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine?
6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 317.44 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-N-[(E)-1,3-thiazol-2-ylmethylideneamino]thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 53492917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).