C24H16F2N6 — CID 53492945
[2-(3,4-difluorophenyl)-4-(quinolin-5-ylamino)-7,8-dihydro-1,6-naphthyridin-5-yl]cyanamide (PubChem CID 53492945) has the molecular formula C24H16F2N6 and a molecular weight of 426.43 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-4-(quinolin-5-ylamino)-7,8-dihydro-1,6-naphthyridin-5-yl]cyanamide.
| Compound Name | [2-(3,4-difluorophenyl)-4-(quinolin-5-ylamino)-7,8-dihydro-1,6-naphthyridin-5-yl]cyanamide |
|---|---|
| PubChem CID | 53492945 |
| Molecular Formula | C24H16F2N6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | [2-(3,4-difluorophenyl)-4-(quinolin-5-ylamino)-7,8-dihydro-1,6-naphthyridin-5-yl]cyanamide |
| SMILES | N#CNC1=NCCc2nc(-c3ccc(F)c(F)c3)cc(Nc3cccc4ncccc34)c21 |
| InChI | InChI=1S/C24H16F2N6/c25-16-7-6-14(11-17(16)26)21-12-22(23-20(32-21)8-10-29-24(23)30-13-27)31-19-5-1-4-18-15(19)3-2-9-28-18/h1-7,9,11-12H,8,10H2,(H,29,30)(H,31,32) |
| InChIKey | IYUZAUFNGUWGDQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|