C35H34N6O2 — CID 53492947
N-[3-(dimethylamino)propyl]-3-[3-[5-oxo-4-(quinolin-5-ylamino)-7,8-dihydro-6H-1,6-naphthyridin-2-yl]phenyl]benzamide (PubChem CID 53492947) has the molecular formula C35H34N6O2 and a molecular weight of 570.70 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-[3-[5-oxo-4-(quinolin-5-ylamino)-7,8-dihydro-6H-1,6-naphthyridin-2-yl]phenyl]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-[3-[5-oxo-4-(quinolin-5-ylamino)-7,8-dihydro-6H-1,6-naphthyridin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 53492947 |
| Molecular Formula | C35H34N6O2 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-[3-[5-oxo-4-(quinolin-5-ylamino)-7,8-dihydro-6H-1,6-naphthyridin-2-yl]phenyl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1cccc(-c2cccc(-c3cc(Nc4cccc5ncccc45)c4c(n3)CCNC4=O)c2)c1 |
| InChI | InChI=1S/C35H34N6O2/c1-41(2)19-7-17-37-34(42)26-11-4-9-24(21-26)23-8-3-10-25(20-23)31-22-32(33-30(40-31)15-18-38-35(33)43)39-29-14-5-13-28-27(29)12-6-16-36-28/h3-6,8-14,16,20-22H,7,15,17-19H2,1-2H3,(H,37,42)(H,38,43)(H,39,40) |
| InChIKey | QCXFHKAQLCMKFI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|