C19H18N2O2 — CID 53493359
4,5,5-trimethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazolidin-2-one (PubChem CID 53493359) has the molecular formula C19H18N2O2 and a molecular weight of 306.36 g/mol. Its IUPAC name is 4,5,5-trimethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazolidin-2-one.
| Compound Name | 4,5,5-trimethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 53493359 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4,5,5-trimethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazolidin-2-one |
| SMILES | CC1N(c2ccc(C#Cc3ccccc3)cn2)C(=O)OC1(C)C |
| InChI | InChI=1S/C19H18N2O2/c1-14-19(2,3)23-18(22)21(14)17-12-11-16(13-20-17)10-9-15-7-5-4-6-8-15/h4-8,11-14H,1-3H3 |
| InChIKey | QTYZHBVNSBXENQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|