C14H14O5 — CID 53493438
(3R,4R)-3,4-dihydroxy-2,2-dimethyl-3,4-dihydropyrano[3,2-h]chromen-9-one (PubChem CID 53493438) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is (3R,4R)-3,4-dihydroxy-2,2-dimethyl-3,4-dihydropyrano[3,2-h]chromen-9-one.
| Compound Name | (3R,4R)-3,4-dihydroxy-2,2-dimethyl-3,4-dihydropyrano[3,2-h]chromen-9-one |
|---|---|
| PubChem CID | 53493438 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (3R,4R)-3,4-dihydroxy-2,2-dimethyl-3,4-dihydropyrano[3,2-h]chromen-9-one |
| SMILES | CC1(C)Oc2c(ccc3ccc(=O)oc23)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H14O5/c1-14(2)13(17)10(16)8-5-3-7-4-6-9(15)18-11(7)12(8)19-14/h3-6,10,13,16-17H,1-2H3/t10-,13-/m1/s1 |
| InChIKey | GIKJJYIRCGXABX-ZWNOBZJWSA-N |
| XLogP | 1.36 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|