C24H21F3O7 — CID 53493441
[(1R,2R)-2-hydroxy-3,3-dimethyl-8-oxo-1,2-dihydropyrano[3,2-f]chromen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 53493441) has the molecular formula C24H21F3O7 and a molecular weight of 478.42 g/mol. Its IUPAC name is [(1R,2R)-2-hydroxy-3,3-dimethyl-8-oxo-1,2-dihydropyrano[3,2-f]chromen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1R,2R)-2-hydroxy-3,3-dimethyl-8-oxo-1,2-dihydropyrano[3,2-f]chromen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 53493441 |
| Molecular Formula | C24H21F3O7 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | [(1R,2R)-2-hydroxy-3,3-dimethyl-8-oxo-1,2-dihydropyrano[3,2-f]chromen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)O[C@@H]1c2c(ccc3oc(=O)ccc23)OC(C)(C)[C@@H]1O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H21F3O7/c1-22(2)20(29)19(18-14-9-12-17(28)32-15(14)10-11-16(18)34-22)33-21(30)23(31-3,24(25,26)27)13-7-5-4-6-8-13/h4-12,19-20,29H,1-3H3/t19-,20-,23-/m1/s1 |
| InChIKey | PQAJKQDALXAYFC-TXTKFYIRSA-N |
| XLogP | 4.01 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|