C20H21N3O3 — CID 53493642
N-(1,3-benzodioxol-5-yl)-6-methoxy-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine (PubChem CID 53493642) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-methoxy-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-methoxy-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine |
|---|---|
| PubChem CID | 53493642 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-methoxy-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine |
| SMILES | COC1CCc2c(c3ccc(Nc4ccc5c(c4)OCO5)nc3n2C)C1 |
| InChI | InChI=1S/C20H21N3O3/c1-23-16-6-4-13(24-2)10-15(16)14-5-8-19(22-20(14)23)21-12-3-7-17-18(9-12)26-11-25-17/h3,5,7-9,13H,4,6,10-11H2,1-2H3,(H,21,22) |
| InChIKey | UEBHASDZUMCFJA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |