C26H27N3O3S — CID 5349368
2-[4-[(E)-[[2-(4-methylphenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]-N-(1-phenylethyl)acetamide (PubChem CID 5349368) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 2-[4-[(E)-[[2-(4-methylphenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[4-[(E)-[[2-(4-methylphenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 5349368 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-[4-[(E)-[[2-(4-methylphenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]-N-(1-phenylethyl)acetamide |
| SMILES | Cc1ccc(SCC(=O)N/N=C/c2ccc(OCC(=O)NC(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O3S/c1-19-8-14-24(15-9-19)33-18-26(31)29-27-16-21-10-12-23(13-11-21)32-17-25(30)28-20(2)22-6-4-3-5-7-22/h3-16,20H,17-18H2,1-2H3,(H,28,30)(H,29,31)/b27-16+ |
| InChIKey | JQBOVGWUYMCMQI-JVWAILMASA-N |
| XLogP | 4.49 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|