About 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one
4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one (PubChem CID 53493728) has the molecular formula C13H14O4
and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one.
Molecular Properties
| Compound Name | 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one |
| PubChem CID | 53493728 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one |
| SMILES | COc1cc(/C=C/C(C)=C/C(C)=O)oc(=O)c1 |
| InChI | InChI=1S/C13H14O4/c1-9(6-10(2)14)4-5-11-7-12(16-3)8-13(15)17-11/h4-8H,1-3H3/b5-4+,9-6+ |
| InChIKey | LGJCELWOOPXKFE-HSKKLARCSA-N |
| XLogP | 2.20 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one?
The IUPAC name of 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one (CID 53493728) is 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one.
What is the SMILES notation for 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one?
The canonical SMILES for 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one is COc1cc(/C=C/C(C)=C/C(C)=O)oc(=O)c1.
What is the InChIKey of 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one?
The InChIKey is LGJCELWOOPXKFE-HSKKLARCSA-N. The full InChI is InChI=1S/C13H14O4/c1-9(6-10(2)14)4-5-11-7-12(16-3)8-13(15)17-11/h4-8H,1-3H3/b5-4+,9-6+.
What are the key properties of 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one?
4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one has a molecular weight of 234.25 g/mol, XLogP of 2.20, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dienyl]pyran-2-one is sourced from PubChem (CID 53493728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).