C22H24O6 — CID 53493735
7,10-dihydroxy-15-[(E)-4-hydroxy-3-methylbut-2-enyl]-17-methyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraen-14-one (PubChem CID 53493735) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is 7,10-dihydroxy-15-[(E)-4-hydroxy-3-methylbut-2-enyl]-17-methyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraen-14-one.
| Compound Name | 7,10-dihydroxy-15-[(E)-4-hydroxy-3-methylbut-2-enyl]-17-methyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraen-14-one |
|---|---|
| PubChem CID | 53493735 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 7,10-dihydroxy-15-[(E)-4-hydroxy-3-methylbut-2-enyl]-17-methyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraen-14-one |
| SMILES | C/C(=C\CC12OC(C)C3CC(C=C4C(O)c5cc(O)ccc5OC431)C2=O)CO |
| InChI | InChI=1S/C22H24O6/c1-11(10-23)5-6-21-20(26)13-7-16(12(2)27-21)22(21)17(8-13)19(25)15-9-14(24)3-4-18(15)28-22/h3-5,8-9,12-13,16,19,23-25H,6-7,10H2,1-2H3/b11-5+ |
| InChIKey | MGRXYYFOSOQPMX-VZUCSPMQSA-N |
| XLogP | 2.19 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|