C21H19N3O2 — CID 53493858
4-(3-methoxyanilino)-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one (PubChem CID 53493858) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-(3-methoxyanilino)-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one.
| Compound Name | 4-(3-methoxyanilino)-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 53493858 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 4-(3-methoxyanilino)-2-phenyl-7,8-dihydro-6H-1,6-naphthyridin-5-one |
| SMILES | COc1cccc(Nc2cc(-c3ccccc3)nc3c2C(=O)NCC3)c1 |
| InChI | InChI=1S/C21H19N3O2/c1-26-16-9-5-8-15(12-16)23-19-13-18(14-6-3-2-4-7-14)24-17-10-11-22-21(25)20(17)19/h2-9,12-13H,10-11H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | PBJZBHKLXZKPND-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |