About N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine
N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 53493914) has the molecular formula C18H18F2N4
and a molecular weight of 328.37 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine.
Molecular Properties
| Compound Name | N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine |
| PubChem CID | 53493914 |
| Molecular Formula | C18H18F2N4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | Fc1ccc(Nc2ccc3c(C4CCNCC4)c[nH]c3n2)cc1F |
| InChI | InChI=1S/C18H18F2N4/c19-15-3-1-12(9-16(15)20)23-17-4-2-13-14(10-22-18(13)24-17)11-5-7-21-8-6-11/h1-4,9-11,21H,5-8H2,(H2,22,23,24) |
| InChIKey | QRDLRCNFRXXGTE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine?
The IUPAC name of N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine (CID 53493914) is N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine.
What is the SMILES notation for N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine?
The canonical SMILES for N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine is Fc1ccc(Nc2ccc3c(C4CCNCC4)c[nH]c3n2)cc1F.
What is the InChIKey of N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine?
The InChIKey is QRDLRCNFRXXGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2N4/c19-15-3-1-12(9-16(15)20)23-17-4-2-13-14(10-22-18(13)24-17)11-5-7-21-8-6-11/h1-4,9-11,21H,5-8H2,(H2,22,23,24).
What are the key properties of N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine?
N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine has a molecular weight of 328.37 g/mol, XLogP of 4.05, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-difluorophenyl)-3-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine is sourced from PubChem (CID 53493914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).