C18H19NO7 — CID 53493940
methyl (1'R,2'R,6'R,7'R)-4',4'-dimethyl-3-oxospiro[1H-indole-2,10'-3,5,9,11-tetraoxatricyclo[5.3.1.02,6]undecane]-2'-carboxylate (PubChem CID 53493940) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is methyl (1'R,2'R,6'R,7'R)-4',4'-dimethyl-3-oxospiro[1H-indole-2,10'-3,5,9,11-tetraoxatricyclo[5.3.1.02,6]undecane]-2'-carboxylate.
| Compound Name | methyl (1'R,2'R,6'R,7'R)-4',4'-dimethyl-3-oxospiro[1H-indole-2,10'-3,5,9,11-tetraoxatricyclo[5.3.1.02,6]undecane]-2'-carboxylate |
|---|---|
| PubChem CID | 53493940 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | methyl (1'R,2'R,6'R,7'R)-4',4'-dimethyl-3-oxospiro[1H-indole-2,10'-3,5,9,11-tetraoxatricyclo[5.3.1.02,6]undecane]-2'-carboxylate |
| SMILES | COC(=O)[C@@]12OC(C)(C)O[C@@H]1[C@H]1COC3(Nc4ccccc4C3=O)C2O1 |
| InChI | InChI=1S/C18H19NO7/c1-16(2)25-13-11-8-23-18(12(20)9-6-4-5-7-10(9)19-18)14(24-11)17(13,26-16)15(21)22-3/h4-7,11,13-14,19H,8H2,1-3H3/t11-,13-,14?,17-,18?/m1/s1 |
| InChIKey | DLPSWFQKNDNSQC-BHRJFFJISA-N |
| XLogP | 0.85 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |