C11H10F6O4 — CID 53493941
bis(2,2,2-trifluoroethyl) 2-ethenylcyclopropane-1,1-dicarboxylate (PubChem CID 53493941) has the molecular formula C11H10F6O4 and a molecular weight of 320.19 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2-ethenylcyclopropane-1,1-dicarboxylate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2-ethenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 53493941 |
| Molecular Formula | C11H10F6O4 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2-ethenylcyclopropane-1,1-dicarboxylate |
| SMILES | C=CC1CC1(C(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C11H10F6O4/c1-2-6-3-9(6,7(18)20-4-10(12,13)14)8(19)21-5-11(15,16)17/h2,6H,1,3-5H2 |
| InChIKey | UWRHTBKAHHCKKD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|