About methyl aziridine-2-carboxylate
methyl aziridine-2-carboxylate (PubChem CID 534940) has the molecular formula C4H7NO2
and a molecular weight of 101.11 g/mol. Its IUPAC name is methyl aziridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl aziridine-2-carboxylate |
| PubChem CID | 534940 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.11 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | methyl aziridine-2-carboxylate |
| SMILES | COC(=O)C1CN1 |
| InChI | InChI=1S/C4H7NO2/c1-7-4(6)3-2-5-3/h3,5H,2H2,1H3 |
| InChIKey | ZWCVDRJTYFIPIV-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.11 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methyl aziridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl aziridine-2-carboxylate?
The IUPAC name of methyl aziridine-2-carboxylate (CID 534940) is methyl aziridine-2-carboxylate.
What is the SMILES notation for methyl aziridine-2-carboxylate?
The canonical SMILES for methyl aziridine-2-carboxylate is COC(=O)C1CN1.
What is the InChIKey of methyl aziridine-2-carboxylate?
The InChIKey is ZWCVDRJTYFIPIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2/c1-7-4(6)3-2-5-3/h3,5H,2H2,1H3.
What are the key properties of methyl aziridine-2-carboxylate?
methyl aziridine-2-carboxylate has a molecular weight of 101.11 g/mol, XLogP of -0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl aziridine-2-carboxylate is sourced from PubChem (CID 534940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).