About 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine
6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine (PubChem CID 53494047) has the molecular formula C16H20N4O
and a molecular weight of 284.36 g/mol. Its IUPAC name is 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine.
Molecular Properties
| Compound Name | 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine |
| PubChem CID | 53494047 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine |
| SMILES | Cc1cnc(N2CCC(Oc3ccccc3C)CC2)nn1 |
| InChI | InChI=1S/C16H20N4O/c1-12-5-3-4-6-15(12)21-14-7-9-20(10-8-14)16-17-11-13(2)18-19-16/h3-6,11,14H,7-10H2,1-2H3 |
| InChIKey | WJSVQDCBVVDKLI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine?
The IUPAC name of 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine (CID 53494047) is 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine.
What is the SMILES notation for 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine?
The canonical SMILES for 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine is Cc1cnc(N2CCC(Oc3ccccc3C)CC2)nn1.
What is the InChIKey of 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine?
The InChIKey is WJSVQDCBVVDKLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O/c1-12-5-3-4-6-15(12)21-14-7-9-20(10-8-14)16-17-11-13(2)18-19-16/h3-6,11,14H,7-10H2,1-2H3.
What are the key properties of 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine?
6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine has a molecular weight of 284.36 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-[4-(2-methylphenoxy)piperidin-1-yl]-1,2,4-triazine is sourced from PubChem (CID 53494047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).