C15H26O3Si — CID 53494078
(2E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxonona-2,8-dienal (PubChem CID 53494078) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is (2E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxonona-2,8-dienal.
| Compound Name | (2E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxonona-2,8-dienal |
|---|---|
| PubChem CID | 53494078 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (2E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxonona-2,8-dienal |
| SMILES | C=CCC[C@H](O[Si](C)(C)C(C)(C)C)C(=O)/C=C/C=O |
| InChI | InChI=1S/C15H26O3Si/c1-7-8-11-14(13(17)10-9-12-16)18-19(5,6)15(2,3)4/h7,9-10,12,14H,1,8,11H2,2-6H3/b10-9+/t14-/m0/s1 |
| InChIKey | BGUJIGVOFAGYLE-HBWSCVEGSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|