C24H28O4 — CID 53494256
4-[(E)-2-[(1S,2R)-2-(3,4-dimethoxyphenyl)cyclohex-3-en-1-yl]ethenyl]-1,2-dimethoxybenzene (PubChem CID 53494256) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is 4-[(E)-2-[(1S,2R)-2-(3,4-dimethoxyphenyl)cyclohex-3-en-1-yl]ethenyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[(E)-2-[(1S,2R)-2-(3,4-dimethoxyphenyl)cyclohex-3-en-1-yl]ethenyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 53494256 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 4-[(E)-2-[(1S,2R)-2-(3,4-dimethoxyphenyl)cyclohex-3-en-1-yl]ethenyl]-1,2-dimethoxybenzene |
| SMILES | COc1ccc(/C=C/[C@@H]2CCC=C[C@H]2c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H28O4/c1-25-21-13-10-17(15-23(21)27-3)9-11-18-7-5-6-8-20(18)19-12-14-22(26-2)24(16-19)28-4/h6,8-16,18,20H,5,7H2,1-4H3/b11-9+/t18-,20+/m0/s1 |
| InChIKey | PHLVYOUORNHOLU-UZOQORDWSA-N |
| XLogP | 5.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|