C20H18N4O2 — CID 53494264
4-(3-methoxyanilino)-2-pyridin-4-yl-7,8-dihydro-6H-1,6-naphthyridin-5-one (PubChem CID 53494264) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-(3-methoxyanilino)-2-pyridin-4-yl-7,8-dihydro-6H-1,6-naphthyridin-5-one.
| Compound Name | 4-(3-methoxyanilino)-2-pyridin-4-yl-7,8-dihydro-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 53494264 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-(3-methoxyanilino)-2-pyridin-4-yl-7,8-dihydro-6H-1,6-naphthyridin-5-one |
| SMILES | COc1cccc(Nc2cc(-c3ccncc3)nc3c2C(=O)NCC3)c1 |
| InChI | InChI=1S/C20H18N4O2/c1-26-15-4-2-3-14(11-15)23-18-12-17(13-5-8-21-9-6-13)24-16-7-10-22-20(25)19(16)18/h2-6,8-9,11-12H,7,10H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | IQEPGIPLJGRQOD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |