C20H32 — CID 534943
3,3,6,6,9,9,12,12-octamethylpentacyclo[9.1.0.02,4.05,7.08,10]dodecane (PubChem CID 534943) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is 3,3,6,6,9,9,12,12-octamethylpentacyclo[9.1.0.02,4.05,7.08,10]dodecane.
| Compound Name | 3,3,6,6,9,9,12,12-octamethylpentacyclo[9.1.0.02,4.05,7.08,10]dodecane |
|---|---|
| PubChem CID | 534943 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 3,3,6,6,9,9,12,12-octamethylpentacyclo[9.1.0.02,4.05,7.08,10]dodecane |
| SMILES | CC1(C)C2C1C1C(C3C(C4C2C4(C)C)C3(C)C)C1(C)C |
| InChI | InChI=1S/C20H32/c1-17(2)9-10(17)12-14(19(12,5)6)16-15(20(16,7)8)13-11(9)18(13,3)4/h9-16H,1-8H3 |
| InChIKey | HXRPCADGDWCZRX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|