C14H27IO2Si — CID 53494349
(E,2S,3R)-6-iodo-2,5-dimethyl-3-triethylsilyloxyhex-5-enal (PubChem CID 53494349) has the molecular formula C14H27IO2Si and a molecular weight of 382.36 g/mol. Its IUPAC name is (E,2S,3R)-6-iodo-2,5-dimethyl-3-triethylsilyloxyhex-5-enal.
| Compound Name | (E,2S,3R)-6-iodo-2,5-dimethyl-3-triethylsilyloxyhex-5-enal |
|---|---|
| PubChem CID | 53494349 |
| Molecular Formula | C14H27IO2Si |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (E,2S,3R)-6-iodo-2,5-dimethyl-3-triethylsilyloxyhex-5-enal |
| SMILES | CC[Si](CC)(CC)O[C@H](C/C(C)=C/I)[C@H](C)C=O |
| InChI | InChI=1S/C14H27IO2Si/c1-6-18(7-2,8-3)17-14(13(5)11-16)9-12(4)10-15/h10-11,13-14H,6-9H2,1-5H3/b12-10+/t13-,14-/m1/s1 |
| InChIKey | UHLFFCCVYBDKPZ-XMNZZIDVSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|