C19H20FN3S — CID 53494434
6-(2-fluoro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5H-1,3-thiazole]-2'-amine (PubChem CID 53494434) has the molecular formula C19H20FN3S and a molecular weight of 341.46 g/mol. Its IUPAC name is 6-(2-fluoro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5H-1,3-thiazole]-2'-amine.
| Compound Name | 6-(2-fluoro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5H-1,3-thiazole]-2'-amine |
|---|---|
| PubChem CID | 53494434 |
| Molecular Formula | C19H20FN3S |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 6-(2-fluoro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5H-1,3-thiazole]-2'-amine |
| SMILES | CC1(C)Cc2ccc(-c3cccnc3F)cc2C2(CSC(N)=N2)C1 |
| InChI | InChI=1S/C19H20FN3S/c1-18(2)9-13-6-5-12(14-4-3-7-22-16(14)20)8-15(13)19(10-18)11-24-17(21)23-19/h3-8H,9-11H2,1-2H3,(H2,21,23) |
| InChIKey | LITFXRRTCOLEKB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|