About (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate
(6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate (PubChem CID 53494452) has the molecular formula C12H15N5O3
and a molecular weight of 277.28 g/mol. Its IUPAC name is (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate.
Molecular Properties
| Compound Name | (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate |
| PubChem CID | 53494452 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1cnc(-n2cccn2)[nH]c1=O |
| InChI | InChI=1S/C12H15N5O3/c1-12(2,3)16-11(19)20-8-7-13-10(15-9(8)18)17-6-4-5-14-17/h4-7H,1-3H3,(H,16,19)(H,13,15,18) |
| InChIKey | JLCYBYMZTSXUIG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate?
The IUPAC name of (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate (CID 53494452) is (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate.
What is the SMILES notation for (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate?
The canonical SMILES for (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate is CC(C)(C)NC(=O)Oc1cnc(-n2cccn2)[nH]c1=O.
What is the InChIKey of (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate?
The InChIKey is JLCYBYMZTSXUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5O3/c1-12(2,3)16-11(19)20-8-7-13-10(15-9(8)18)17-6-4-5-14-17/h4-7H,1-3H3,(H,16,19)(H,13,15,18).
What are the key properties of (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate?
(6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate has a molecular weight of 277.28 g/mol, XLogP of 0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-oxo-2-pyrazol-1-yl-1H-pyrimidin-5-yl) N-tert-butylcarbamate is sourced from PubChem (CID 53494452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).