C20H21FN4O — CID 53494692
2'-amino-6-(2-fluoro-3-pyridinyl)-2,2,3'-trimethylspiro[1,3-dihydronaphthalene-4,5'-imidazole]-4'-one (PubChem CID 53494692) has the molecular formula C20H21FN4O and a molecular weight of 352.41 g/mol. Its IUPAC name is 2'-amino-6-(2-fluoro-3-pyridinyl)-2,2,3'-trimethylspiro[1,3-dihydronaphthalene-4,5'-imidazole]-4'-one.
| Compound Name | 2'-amino-6-(2-fluoro-3-pyridinyl)-2,2,3'-trimethylspiro[1,3-dihydronaphthalene-4,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 53494692 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2'-amino-6-(2-fluoro-3-pyridinyl)-2,2,3'-trimethylspiro[1,3-dihydronaphthalene-4,5'-imidazole]-4'-one |
| SMILES | CN1C(=O)C2(CC(C)(C)Cc3ccc(-c4cccnc4F)cc32)N=C1N |
| InChI | InChI=1S/C20H21FN4O/c1-19(2)10-13-7-6-12(14-5-4-8-23-16(14)21)9-15(13)20(11-19)17(26)25(3)18(22)24-20/h4-9H,10-11H2,1-3H3,(H2,22,24) |
| InChIKey | QOSNPHUJYRNMGO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|