About 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one
4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one (PubChem CID 53494818) has the molecular formula C19H12F3N3O2
and a molecular weight of 371.32 g/mol. Its IUPAC name is 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one |
| PubChem CID | 53494818 |
| Molecular Formula | C19H12F3N3O2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one |
| SMILES | O=c1cc(-c2c[nH]c3ncccc23)cc(-c2cccc(OC(F)(F)F)c2)[nH]1 |
| InChI | InChI=1S/C19H12F3N3O2/c20-19(21,22)27-13-4-1-3-11(7-13)16-8-12(9-17(26)25-16)15-10-24-18-14(15)5-2-6-23-18/h1-10H,(H,23,24)(H,25,26) |
| InChIKey | KEESZFVFGKHGKG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one?
The IUPAC name of 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one (CID 53494818) is 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one.
What is the SMILES notation for 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one?
The canonical SMILES for 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one is O=c1cc(-c2c[nH]c3ncccc23)cc(-c2cccc(OC(F)(F)F)c2)[nH]1.
What is the InChIKey of 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one?
The InChIKey is KEESZFVFGKHGKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F3N3O2/c20-19(21,22)27-13-4-1-3-11(7-13)16-8-12(9-17(26)25-16)15-10-24-18-14(15)5-2-6-23-18/h1-10H,(H,23,24)(H,25,26).
What are the key properties of 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one?
4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one has a molecular weight of 371.32 g/mol, XLogP of 4.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[3-(trifluoromethoxy)phenyl]-1H-pyridin-2-one is sourced from PubChem (CID 53494818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).