C23H22O3S — CID 53494870
1,3-bis(4-methoxyphenyl)-3-phenylsulfanylpropan-1-one (PubChem CID 53494870) has the molecular formula C23H22O3S and a molecular weight of 378.49 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)-3-phenylsulfanylpropan-1-one.
| Compound Name | 1,3-bis(4-methoxyphenyl)-3-phenylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 53494870 |
| Molecular Formula | C23H22O3S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)-3-phenylsulfanylpropan-1-one |
| SMILES | COc1ccc(C(=O)CC(Sc2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H22O3S/c1-25-19-12-8-17(9-13-19)22(24)16-23(27-21-6-4-3-5-7-21)18-10-14-20(26-2)15-11-18/h3-15,23H,16H2,1-2H3 |
| InChIKey | BZZCQXIXDXRBLL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |