C26H33ClO7 — CID 53494878
(1S,16R,17S,18R,19R)-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,14,20-trioxatricyclo[14.3.1.02,7]icosa-2(7),3,5-triene-17,18,19-triol (PubChem CID 53494878) has the molecular formula C26H33ClO7 and a molecular weight of 493.00 g/mol. Its IUPAC name is (1S,16R,17S,18R,19R)-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,14,20-trioxatricyclo[14.3.1.02,7]icosa-2(7),3,5-triene-17,18,19-triol.
| Compound Name | (1S,16R,17S,18R,19R)-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,14,20-trioxatricyclo[14.3.1.02,7]icosa-2(7),3,5-triene-17,18,19-triol |
|---|---|
| PubChem CID | 53494878 |
| Molecular Formula | C26H33ClO7 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | (1S,16R,17S,18R,19R)-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,14,20-trioxatricyclo[14.3.1.02,7]icosa-2(7),3,5-triene-17,18,19-triol |
| SMILES | CCOc1ccc(Cc2cc3c(cc2Cl)OCCCCCOC[C@H]2O[C@@H]3[C@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C26H33ClO7/c1-2-32-18-8-6-16(7-9-18)12-17-13-19-21(14-20(17)27)33-11-5-3-4-10-31-15-22-23(28)24(29)25(30)26(19)34-22/h6-9,13-14,22-26,28-30H,2-5,10-12,15H2,1H3/t22-,23-,24+,25-,26+/m1/s1 |
| InChIKey | KWHJCXJWRDCRNS-RTJMFUJLSA-N |
| XLogP | 3.43 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |