C17H17NO — CID 53494936
7-amino-4-phenyl-5,7,8,9-tetrahydrobenzo[7]annulen-6-one (PubChem CID 53494936) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 7-amino-4-phenyl-5,7,8,9-tetrahydrobenzo[7]annulen-6-one.
| Compound Name | 7-amino-4-phenyl-5,7,8,9-tetrahydrobenzo[7]annulen-6-one |
|---|---|
| PubChem CID | 53494936 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 7-amino-4-phenyl-5,7,8,9-tetrahydrobenzo[7]annulen-6-one |
| SMILES | NC1CCc2cccc(-c3ccccc3)c2CC1=O |
| InChI | InChI=1S/C17H17NO/c18-16-10-9-13-7-4-8-14(15(13)11-17(16)19)12-5-2-1-3-6-12/h1-8,16H,9-11,18H2 |
| InChIKey | OCPQVXLDVBEGMQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |