C30H31Cl2N3O5 — CID 53494982
2-acetamidoethyl 4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carboxylate (PubChem CID 53494982) has the molecular formula C30H31Cl2N3O5 and a molecular weight of 584.50 g/mol. Its IUPAC name is 2-acetamidoethyl 4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carboxylate.
| Compound Name | 2-acetamidoethyl 4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carboxylate |
|---|---|
| PubChem CID | 53494982 |
| Molecular Formula | C30H31Cl2N3O5 |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 2-acetamidoethyl 4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carboxylate |
| SMILES | COc1ccc(C2=NC(c3ccc(Cl)cc3)C(c3ccc(Cl)cc3)N2C(=O)OCCNC(C)=O)c(OC(C)C)c1 |
| InChI | InChI=1S/C30H31Cl2N3O5/c1-18(2)40-26-17-24(38-4)13-14-25(26)29-34-27(20-5-9-22(31)10-6-20)28(21-7-11-23(32)12-8-21)35(29)30(37)39-16-15-33-19(3)36/h5-14,17-18,27-28H,15-16H2,1-4H3,(H,33,36) |
| InChIKey | HNUNESUWSUPMBR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|