About 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide
3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide (PubChem CID 53495253) has the molecular formula C21H20F2N4O
and a molecular weight of 382.41 g/mol. Its IUPAC name is 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide.
Molecular Properties
| Compound Name | 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide |
| PubChem CID | 53495253 |
| Molecular Formula | C21H20F2N4O |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide |
| SMILES | CC(C)(CNc1ccc(-c2cccc(C(N)=O)c2)nn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H20F2N4O/c1-21(2,16-7-6-15(22)11-17(16)23)12-25-19-9-8-18(26-27-19)13-4-3-5-14(10-13)20(24)28/h3-11H,12H2,1-2H3,(H2,24,28)(H,25,27) |
| InChIKey | GHMBHZFWFYJOQH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide?
The IUPAC name of 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide (CID 53495253) is 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide.
What is the SMILES notation for 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide?
The canonical SMILES for 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide is CC(C)(CNc1ccc(-c2cccc(C(N)=O)c2)nn1)c1ccc(F)cc1F.
What is the InChIKey of 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide?
The InChIKey is GHMBHZFWFYJOQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F2N4O/c1-21(2,16-7-6-15(22)11-17(16)23)12-25-19-9-8-18(26-27-19)13-4-3-5-14(10-13)20(24)28/h3-11H,12H2,1-2H3,(H2,24,28)(H,25,27).
What are the key properties of 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide?
3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide has a molecular weight of 382.41 g/mol, XLogP of 3.91, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[[2-(2,4-difluorophenyl)-2-methylpropyl]amino]pyridazin-3-yl]benzamide is sourced from PubChem (CID 53495253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).