C26H46O2Si — CID 53495313
(3S,4aR,4bS,8aS,10aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthrene-1-carbaldehyde (PubChem CID 53495313) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is (3S,4aR,4bS,8aS,10aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthrene-1-carbaldehyde.
| Compound Name | (3S,4aR,4bS,8aS,10aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthrene-1-carbaldehyde |
|---|---|
| PubChem CID | 53495313 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (3S,4aR,4bS,8aS,10aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthrene-1-carbaldehyde |
| SMILES | CC1=C(C=O)[C@]2(C)CC[C@H]3C(C)(C)CCC[C@]3(C)[C@H]2C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O2Si/c1-18-19(17-27)25(7)15-12-21-24(5,6)13-11-14-26(21,8)22(25)16-20(18)28-29(9,10)23(2,3)4/h17,20-22H,11-16H2,1-10H3/t20-,21-,22-,25-,26-/m0/s1 |
| InChIKey | ABUCJXAFNQYXNW-GIDZJRPFSA-N |
| XLogP | 7.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|