C22H20BF2N3 — CID 53495320
2,2-difluoro-4-(1H-pyrrol-2-yl)-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 53495320) has the molecular formula C22H20BF2N3 and a molecular weight of 375.23 g/mol. Its IUPAC name is 2,2-difluoro-4-(1H-pyrrol-2-yl)-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4-(1H-pyrrol-2-yl)-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 53495320 |
| Molecular Formula | C22H20BF2N3 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2,2-difluoro-4-(1H-pyrrol-2-yl)-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1cc(C)c(C2=C3C=CC=[N+]3[B-](F)(F)n3c2ccc3-c2ccc[nH]2)c(C)c1 |
| InChI | InChI=1S/C22H20BF2N3/c1-14-12-15(2)21(16(3)13-14)22-19-7-5-11-27(19)23(24,25)28-18(8-9-20(22)28)17-6-4-10-26-17/h4-13,26H,1-3H3 |
| InChIKey | KYNWQKVLRANCDB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 23.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|