C20H34O4 — CID 53495362
(1S,2S,5Z,9R,10E,12S)-5-(hydroxymethyl)-1,9-dimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,10-diene-2,9-diol (PubChem CID 53495362) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (1S,2S,5Z,9R,10E,12S)-5-(hydroxymethyl)-1,9-dimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,10-diene-2,9-diol.
| Compound Name | (1S,2S,5Z,9R,10E,12S)-5-(hydroxymethyl)-1,9-dimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,10-diene-2,9-diol |
|---|---|
| PubChem CID | 53495362 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (1S,2S,5Z,9R,10E,12S)-5-(hydroxymethyl)-1,9-dimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,10-diene-2,9-diol |
| SMILES | CC(C)[C@]12/C=C/[C@](C)(O)CC/C=C(\CO)CC[C@H](O)[C@](C)(CC1)O2 |
| InChI | InChI=1S/C20H34O4/c1-15(2)20-12-10-18(3,23)9-5-6-16(14-21)7-8-17(22)19(4,24-20)11-13-20/h6,10,12,15,17,21-23H,5,7-9,11,13-14H2,1-4H3/b12-10+,16-6-/t17-,18+,19-,20-/m0/s1 |
| InChIKey | TZSLUUFHOBWCSG-UQQBDNORSA-N |
| XLogP | 3.11 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|