About 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one
8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one (PubChem CID 53495489) has the molecular formula C23H15N3O2
and a molecular weight of 365.39 g/mol. Its IUPAC name is 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one.
Molecular Properties
| Compound Name | 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one |
| PubChem CID | 53495489 |
| Molecular Formula | C23H15N3O2 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one |
| SMILES | O=c1ccc2nc(-c3ccccc3)nn(-c3ccccc3)c-2c1-c1ccco1 |
| InChI | InChI=1S/C23H15N3O2/c27-19-14-13-18-22(21(19)20-12-7-15-28-20)26(17-10-5-2-6-11-17)25-23(24-18)16-8-3-1-4-9-16/h1-15H |
| InChIKey | WMLODSPOUMILQG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one?
The IUPAC name of 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one (CID 53495489) is 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one.
What is the SMILES notation for 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one?
The canonical SMILES for 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one is O=c1ccc2nc(-c3ccccc3)nn(-c3ccccc3)c-2c1-c1ccco1.
What is the InChIKey of 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one?
The InChIKey is WMLODSPOUMILQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15N3O2/c27-19-14-13-18-22(21(19)20-12-7-15-28-20)26(17-10-5-2-6-11-17)25-23(24-18)16-8-3-1-4-9-16/h1-15H.
What are the key properties of 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one?
8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one has a molecular weight of 365.39 g/mol, XLogP of 4.66, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(furan-2-yl)-1,3-diphenyl-1,2,4-benzotriazin-7-one is sourced from PubChem (CID 53495489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).