About 4,8-dimethylnona-1,7-diene
4,8-dimethylnona-1,7-diene (PubChem CID 534956) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is 4,8-dimethylnona-1,7-diene.
Molecular Properties
| Compound Name | 4,8-dimethylnona-1,7-diene |
| PubChem CID | 534956 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 4,8-dimethylnona-1,7-diene |
| SMILES | C=CCC(C)CCC=C(C)C |
| InChI | InChI=1S/C11H20/c1-5-7-11(4)9-6-8-10(2)3/h5,8,11H,1,6-7,9H2,2-4H3 |
| InChIKey | WJBLCSOLILMHEZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,8-dimethylnona-1,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethylnona-1,7-diene?
The IUPAC name of 4,8-dimethylnona-1,7-diene (CID 534956) is 4,8-dimethylnona-1,7-diene.
What is the SMILES notation for 4,8-dimethylnona-1,7-diene?
The canonical SMILES for 4,8-dimethylnona-1,7-diene is C=CCC(C)CCC=C(C)C.
What is the InChIKey of 4,8-dimethylnona-1,7-diene?
The InChIKey is WJBLCSOLILMHEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20/c1-5-7-11(4)9-6-8-10(2)3/h5,8,11H,1,6-7,9H2,2-4H3.
What are the key properties of 4,8-dimethylnona-1,7-diene?
4,8-dimethylnona-1,7-diene has a molecular weight of 152.28 g/mol, XLogP of 3.94, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethylnona-1,7-diene is sourced from PubChem (CID 534956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).