C20H32O3 — CID 53495637
(1S,2S,5Z,8Z,10E,12S)-5-(hydroxymethyl)-1,9-dimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,8,10-trien-2-ol (PubChem CID 53495637) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1S,2S,5Z,8Z,10E,12S)-5-(hydroxymethyl)-1,9-dimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,8,10-trien-2-ol.
| Compound Name | (1S,2S,5Z,8Z,10E,12S)-5-(hydroxymethyl)-1,9-dimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,8,10-trien-2-ol |
|---|---|
| PubChem CID | 53495637 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1S,2S,5Z,8Z,10E,12S)-5-(hydroxymethyl)-1,9-dimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,8,10-trien-2-ol |
| SMILES | CC1=C/C/C=C(\CO)CC[C@H](O)[C@]2(C)CC[C@](C(C)C)(/C=C/1)O2 |
| InChI | InChI=1S/C20H32O3/c1-15(2)20-11-10-16(3)6-5-7-17(14-21)8-9-18(22)19(4,23-20)12-13-20/h6-7,10-11,15,18,21-22H,5,8-9,12-14H2,1-4H3/b11-10+,16-6-,17-7-/t18-,19-,20-/m0/s1 |
| InChIKey | SBGIYBFICMPTKN-NFGRDMJDSA-N |
| XLogP | 3.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|