C28H22F6N6O6 — CID 53495939
2-hydroxy-N-(3-imidazol-1-ylpropyl)-2-[4-[5-[5-phenyl-4-(trifluoromethyl)-1,2-oxazol-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 53495939) has the molecular formula C28H22F6N6O6 and a molecular weight of 652.51 g/mol. Its IUPAC name is 2-hydroxy-N-(3-imidazol-1-ylpropyl)-2-[4-[5-[5-phenyl-4-(trifluoromethyl)-1,2-oxazol-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-hydroxy-N-(3-imidazol-1-ylpropyl)-2-[4-[5-[5-phenyl-4-(trifluoromethyl)-1,2-oxazol-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53495939 |
| Molecular Formula | C28H22F6N6O6 |
| Molecular Weight | 652.51 g/mol |
| Exact Mass | 652.15 |
| IUPAC Name | 2-hydroxy-N-(3-imidazol-1-ylpropyl)-2-[4-[5-[5-phenyl-4-(trifluoromethyl)-1,2-oxazol-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCCCn1ccnc1)C(O)c1ccc(-c2noc(-c3noc(-c4ccccc4)c3C(F)(F)F)n2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H21F3N6O4.C2HF3O2/c27-26(28,29)19-20(33-38-22(19)17-5-2-1-3-6-17)25-32-23(34-39-25)18-9-7-16(8-10-18)21(36)24(37)31-11-4-13-35-14-12-30-15-35;3-2(4,5)1(6)7/h1-3,5-10,12,14-15,21,36H,4,11,13H2,(H,31,37);(H,6,7) |
| InChIKey | PRWQNIDDVKAFIR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 169.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|