About 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione
3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione (PubChem CID 53496108) has the molecular formula C14H9ClN2S2
and a molecular weight of 304.83 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione |
| PubChem CID | 53496108 |
| Molecular Formula | C14H9ClN2S2 |
| Molecular Weight | 304.83 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione |
| SMILES | S=c1[nH]c2ccccc2c(=S)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H9ClN2S2/c15-9-4-3-5-10(8-9)17-13(18)11-6-1-2-7-12(11)16-14(17)19/h1-8H,(H,16,19) |
| InChIKey | GCHODLUCPQGHBL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.83 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione?
The IUPAC name of 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione (CID 53496108) is 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione.
What is the SMILES notation for 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione?
The canonical SMILES for 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione is S=c1[nH]c2ccccc2c(=S)n1-c1cccc(Cl)c1.
What is the InChIKey of 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione?
The InChIKey is GCHODLUCPQGHBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClN2S2/c15-9-4-3-5-10(8-9)17-13(18)11-6-1-2-7-12(11)16-14(17)19/h1-8H,(H,16,19).
What are the key properties of 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione?
3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione has a molecular weight of 304.83 g/mol, XLogP of 5.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-1H-quinazoline-2,4-dithione is sourced from PubChem (CID 53496108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).